C19H14F3N5O — CID 11222877
4-[[5-methyl-7-[3-(trifluoromethyl)phenyl]imidazo[5,1-f][1,2,4]triazin-2-yl]amino]phenol (PubChem CID 11222877) has the molecular formula C19H14F3N5O and a molecular weight of 385.35 g/mol. Its IUPAC name is 4-[[5-methyl-7-[3-(trifluoromethyl)phenyl]imidazo[5,1-f][1,2,4]triazin-2-yl]amino]phenol.
| Compound Name | 4-[[5-methyl-7-[3-(trifluoromethyl)phenyl]imidazo[5,1-f][1,2,4]triazin-2-yl]amino]phenol |
|---|---|
| PubChem CID | 11222877 |
| Molecular Formula | C19H14F3N5O |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | 4-[[5-methyl-7-[3-(trifluoromethyl)phenyl]imidazo[5,1-f][1,2,4]triazin-2-yl]amino]phenol |
| SMILES | Cc1nc(-c2cccc(C(F)(F)F)c2)n2nc(Nc3ccc(O)cc3)ncc12 |
| InChI | InChI=1S/C19H14F3N5O/c1-11-16-10-23-18(25-14-5-7-15(28)8-6-14)26-27(16)17(24-11)12-3-2-4-13(9-12)19(20,21)22/h2-10,28H,1H3,(H,25,26) |
| InChIKey | YMPKHSQETUYUAL-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|