C20H23ClN4O2 — CID 11222924
3-(4-chlorophenyl)-9-(1-methoxybutyl)-6-methyl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one (PubChem CID 11222924) has the molecular formula C20H23ClN4O2 and a molecular weight of 386.88 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-9-(1-methoxybutyl)-6-methyl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one.
| Compound Name | 3-(4-chlorophenyl)-9-(1-methoxybutyl)-6-methyl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
|---|---|
| PubChem CID | 11222924 |
| Molecular Formula | C20H23ClN4O2 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 3-(4-chlorophenyl)-9-(1-methoxybutyl)-6-methyl-1,3,5,9-tetrazatricyclo[6.3.1.04,12]dodeca-4,6,8(12)-trien-2-one |
| SMILES | CCCC(OC)N1CCn2c(=O)n(-c3ccc(Cl)cc3)c3nc(C)cc1c32 |
| InChI | InChI=1S/C20H23ClN4O2/c1-4-5-17(27-3)23-10-11-24-18-16(23)12-13(2)22-19(18)25(20(24)26)15-8-6-14(21)7-9-15/h6-9,12,17H,4-5,10-11H2,1-3H3 |
| InChIKey | WDFMUQGJYGNWBY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |