C21H30O7 — CID 11223151
[(1E,7S,8S,9R)-7,9-diacetyloxy-5-methylidene-6-oxo-8-propan-2-ylcyclodecen-1-yl]methyl acetate (PubChem CID 11223151) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is [(1E,7S,8S,9R)-7,9-diacetyloxy-5-methylidene-6-oxo-8-propan-2-ylcyclodecen-1-yl]methyl acetate.
| Compound Name | [(1E,7S,8S,9R)-7,9-diacetyloxy-5-methylidene-6-oxo-8-propan-2-ylcyclodecen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 11223151 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [(1E,7S,8S,9R)-7,9-diacetyloxy-5-methylidene-6-oxo-8-propan-2-ylcyclodecen-1-yl]methyl acetate |
| SMILES | C=C1CC/C=C(/COC(C)=O)C[C@@H](OC(C)=O)[C@H](C(C)C)[C@H](OC(C)=O)C1=O |
| InChI | InChI=1S/C21H30O7/c1-12(2)19-18(27-15(5)23)10-17(11-26-14(4)22)9-7-8-13(3)20(25)21(19)28-16(6)24/h9,12,18-19,21H,3,7-8,10-11H2,1-2,4-6H3/b17-9+/t18-,19+,21+/m1/s1 |
| InChIKey | XFOYHMKDRKVKPJ-NRYJDXOVSA-N |
| XLogP | 2.92 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|