C20H19ClN6O — CID 11223168
(3S)-1-[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]pyrrolidin-3-ol (PubChem CID 11223168) has the molecular formula C20H19ClN6O and a molecular weight of 394.87 g/mol. Its IUPAC name is (3S)-1-[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 11223168 |
| Molecular Formula | C20H19ClN6O |
| Molecular Weight | 394.87 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (3S)-1-[7-(2-chloro-6-methylanilino)-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,10,12-hexaen-12-yl]pyrrolidin-3-ol |
| SMILES | Cc1cccc(Cl)c1Nc1nc2ccc(N3CC[C@H](O)C3)nc2n2cncc12 |
| InChI | InChI=1S/C20H19ClN6O/c1-12-3-2-4-14(21)18(12)25-19-16-9-22-11-27(16)20-15(23-19)5-6-17(24-20)26-8-7-13(28)10-26/h2-6,9,11,13,28H,7-8,10H2,1H3,(H,23,25)/t13-/m0/s1 |
| InChIKey | HAQFEVNHDLLLPV-ZDUSSCGKSA-N |
| XLogP | 3.55 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.87 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |