C21H37BO6 — CID 11223197
bis(2,4-dimethylpentan-3-yl) (4R,5R)-2-prop-2-enyl-1,3,2-dioxaborolane-4,5-dicarboxylate (PubChem CID 11223197) has the molecular formula C21H37BO6 and a molecular weight of 396.33 g/mol. Its IUPAC name is bis(2,4-dimethylpentan-3-yl) (4R,5R)-2-prop-2-enyl-1,3,2-dioxaborolane-4,5-dicarboxylate.
| Compound Name | bis(2,4-dimethylpentan-3-yl) (4R,5R)-2-prop-2-enyl-1,3,2-dioxaborolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11223197 |
| Molecular Formula | C21H37BO6 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 396.27 |
| IUPAC Name | bis(2,4-dimethylpentan-3-yl) (4R,5R)-2-prop-2-enyl-1,3,2-dioxaborolane-4,5-dicarboxylate |
| SMILES | C=CCB1O[C@@H](C(=O)OC(C(C)C)C(C)C)[C@H](C(=O)OC(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C21H37BO6/c1-10-11-22-27-18(20(23)25-16(12(2)3)13(4)5)19(28-22)21(24)26-17(14(6)7)15(8)9/h10,12-19H,1,11H2,2-9H3/t18-,19-/m1/s1 |
| InChIKey | BTULRTZPTDRMER-RTBURBONSA-N |
| XLogP | 3.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|