C23H19F3N2O — CID 11223204
10,10-dimethyl-4-[2-(trifluoromethyl)phenyl]-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene (PubChem CID 11223204) has the molecular formula C23H19F3N2O and a molecular weight of 396.41 g/mol. Its IUPAC name is 10,10-dimethyl-4-[2-(trifluoromethyl)phenyl]-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene.
| Compound Name | 10,10-dimethyl-4-[2-(trifluoromethyl)phenyl]-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene |
|---|---|
| PubChem CID | 11223204 |
| Molecular Formula | C23H19F3N2O |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 10,10-dimethyl-4-[2-(trifluoromethyl)phenyl]-11-oxa-3,5-diazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),4,7(12),13,15-hexaene |
| SMILES | CC1(C)CCc2c(c3ccccc3c3[nH]c(-c4ccccc4C(F)(F)F)nc23)O1 |
| InChI | InChI=1S/C23H19F3N2O/c1-22(2)12-11-16-19-18(13-7-3-4-8-14(13)20(16)29-22)27-21(28-19)15-9-5-6-10-17(15)23(24,25)26/h3-10H,11-12H2,1-2H3,(H,27,28) |
| InChIKey | JUXREQNNIHTWPA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |