About 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine
1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine (PubChem CID 1122329) has the molecular formula C20H26N2O4S
and a molecular weight of 390.51 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine.
Molecular Properties
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine |
| PubChem CID | 1122329 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(CN2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1OC |
| InChI | InChI=1S/C20H26N2O4S/c1-16-4-7-18(8-5-16)27(23,24)22-12-10-21(11-13-22)15-17-6-9-19(25-2)20(14-17)26-3/h4-9,14H,10-13,15H2,1-3H3 |
| InChIKey | IBKIMYVMLAEQOM-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine?
The IUPAC name of 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine (CID 1122329) is 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine.
What is the SMILES notation for 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine?
The canonical SMILES for 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine is COc1ccc(CN2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1OC.
What is the InChIKey of 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine?
The InChIKey is IBKIMYVMLAEQOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26N2O4S/c1-16-4-7-18(8-5-16)27(23,24)22-12-10-21(11-13-22)15-17-6-9-19(25-2)20(14-17)26-3/h4-9,14H,10-13,15H2,1-3H3.
What are the key properties of 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine?
1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine has a molecular weight of 390.51 g/mol, XLogP of 2.52, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3,4-dimethoxyphenyl)methyl]-4-(4-methylphenyl)sulfonylpiperazine is sourced from PubChem (CID 1122329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).