C19H23F2NO4S — CID 11223293
diethyl (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[(4-fluorophenyl)methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylate (PubChem CID 11223293) has the molecular formula C19H23F2NO4S and a molecular weight of 399.46 g/mol. Its IUPAC name is diethyl (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[(4-fluorophenyl)methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylate.
| Compound Name | diethyl (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[(4-fluorophenyl)methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 11223293 |
| Molecular Formula | C19H23F2NO4S |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | diethyl (1R,2S,3R,5R,6R)-2-amino-6-fluoro-3-[(4-fluorophenyl)methylsulfanyl]bicyclo[3.1.0]hexane-2,6-dicarboxylate |
| SMILES | CCOC(=O)[C@@]1(N)[C@H]2[C@@H](C[C@H]1SCc1ccc(F)cc1)[C@]2(F)C(=O)OCC |
| InChI | InChI=1S/C19H23F2NO4S/c1-3-25-16(23)18(21)13-9-14(19(22,15(13)18)17(24)26-4-2)27-10-11-5-7-12(20)8-6-11/h5-8,13-15H,3-4,9-10,22H2,1-2H3/t13-,14-,15+,18-,19+/m1/s1 |
| InChIKey | GKTHYBGSALFKMK-HIGHGGLBSA-N |
| XLogP | 2.61 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |