C26H30N2O2 — CID 11223384
1,2-bis[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-2-hydroxyethanone (PubChem CID 11223384) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 1,2-bis[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-2-hydroxyethanone.
| Compound Name | 1,2-bis[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 11223384 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 1,2-bis[(1R,9R)-10,10-dimethyl-4-azatricyclo[7.1.1.02,7]undeca-2,4,6-trien-5-yl]-2-hydroxyethanone |
| SMILES | CC1(C)[C@H]2Cc3cc(C(=O)C(O)c4cc5c(cn4)[C@@H]4C[C@H](C5)C4(C)C)ncc3[C@@H]1C2 |
| InChI | InChI=1S/C26H30N2O2/c1-25(2)15-5-13-7-21(27-11-17(13)19(25)9-15)23(29)24(30)22-8-14-6-16-10-20(26(16,3)4)18(14)12-28-22/h7-8,11-12,15-16,19-20,23,29H,5-6,9-10H2,1-4H3/t15-,16-,19-,20-,23?/m0/s1 |
| InChIKey | UOQMTKKPIREMPN-ZWIIELQUSA-N |
| XLogP | 4.76 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |