C16H12F3IO — CID 11223415
(Z)-4,4,4-trifluoro-3-iodo-1,1-diphenylbut-2-en-1-ol (PubChem CID 11223415) has the molecular formula C16H12F3IO and a molecular weight of 404.17 g/mol. Its IUPAC name is (Z)-4,4,4-trifluoro-3-iodo-1,1-diphenylbut-2-en-1-ol.
| Compound Name | (Z)-4,4,4-trifluoro-3-iodo-1,1-diphenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 11223415 |
| Molecular Formula | C16H12F3IO |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 403.99 |
| IUPAC Name | (Z)-4,4,4-trifluoro-3-iodo-1,1-diphenylbut-2-en-1-ol |
| SMILES | OC(/C=C(\I)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H12F3IO/c17-16(18,19)14(20)11-15(21,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11,21H/b14-11- |
| InChIKey | VMDKRGZIPGLGGV-KAMYIIQDSA-N |
| XLogP | 4.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|