C19H17ClNO3PS — CID 11223476
[1-(5-chloro-1-benzothiophen-3-yl)-2-oxo-2-[[(E)-2-phenylethenyl]amino]ethyl]-methylphosphinic acid (PubChem CID 11223476) has the molecular formula C19H17ClNO3PS and a molecular weight of 405.84 g/mol. Its IUPAC name is [1-(5-chloro-1-benzothiophen-3-yl)-2-oxo-2-[[(E)-2-phenylethenyl]amino]ethyl]-methylphosphinic acid.
| Compound Name | [1-(5-chloro-1-benzothiophen-3-yl)-2-oxo-2-[[(E)-2-phenylethenyl]amino]ethyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 11223476 |
| Molecular Formula | C19H17ClNO3PS |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | [1-(5-chloro-1-benzothiophen-3-yl)-2-oxo-2-[[(E)-2-phenylethenyl]amino]ethyl]-methylphosphinic acid |
| SMILES | CP(=O)(O)C(C(=O)N/C=C/c1ccccc1)c1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H17ClNO3PS/c1-25(23,24)18(16-12-26-17-8-7-14(20)11-15(16)17)19(22)21-10-9-13-5-3-2-4-6-13/h2-12,18H,1H3,(H,21,22)(H,23,24)/b10-9+ |
| InChIKey | DGWSMOPHIGQBQQ-MDZDMXLPSA-N |
| XLogP | 5.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|