C20H22N6O4 — CID 11223596
tert-butyl N-[4-[[2-[3-(tetrazol-1-yl)phenoxy]acetyl]amino]phenyl]carbamate (PubChem CID 11223596) has the molecular formula C20H22N6O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is tert-butyl N-[4-[[2-[3-(tetrazol-1-yl)phenoxy]acetyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[[2-[3-(tetrazol-1-yl)phenoxy]acetyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 11223596 |
| Molecular Formula | C20H22N6O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | tert-butyl N-[4-[[2-[3-(tetrazol-1-yl)phenoxy]acetyl]amino]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(NC(=O)COc2cccc(-n3cnnn3)c2)cc1 |
| InChI | InChI=1S/C20H22N6O4/c1-20(2,3)30-19(28)23-15-9-7-14(8-10-15)22-18(27)12-29-17-6-4-5-16(11-17)26-13-21-24-25-26/h4-11,13H,12H2,1-3H3,(H,22,27)(H,23,28) |
| InChIKey | GZGWGMKMQMOUJK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |