C19H24BrNS2 — CID 11223597
(1S,5R)-3-(2,2-dithiophen-2-ylethenyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane bromide (PubChem CID 11223597) has the molecular formula C19H24BrNS2 and a molecular weight of 410.45 g/mol. Its IUPAC name is (1S,5R)-3-(2,2-dithiophen-2-ylethenyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane bromide.
| Compound Name | (1S,5R)-3-(2,2-dithiophen-2-ylethenyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane bromide |
|---|---|
| PubChem CID | 11223597 |
| Molecular Formula | C19H24BrNS2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | (1S,5R)-3-(2,2-dithiophen-2-ylethenyl)-8,8-dimethyl-8-azoniabicyclo[3.2.1]octane bromide |
| SMILES | C[N+]1(C)[C@@H]2CC[C@H]1CC(C=C(c1cccs1)c1cccs1)C2.[Br-] |
| InChI | InChI=1S/C19H24NS2.BrH/c1-20(2)15-7-8-16(20)12-14(11-15)13-17(18-5-3-9-21-18)19-6-4-10-22-19;/h3-6,9-10,13-16H,7-8,11-12H2,1-2H3;1H/q+1;/p-1/t14?,15-,16+; |
| InChIKey | BWOXSKDDWQTJRH-XSEGPNBXSA-M |
| XLogP | 2.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|