C22H29F3N2O2 — CID 11223606
ethyl (2S,3S,4R,5S)-3-phenyl-5-propan-2-yl-4-pyrrolidin-1-yl-2-(trifluoromethyl)-2,3,4,5-tetrahydropyridine-6-carboxylate (PubChem CID 11223606) has the molecular formula C22H29F3N2O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is ethyl (2S,3S,4R,5S)-3-phenyl-5-propan-2-yl-4-pyrrolidin-1-yl-2-(trifluoromethyl)-2,3,4,5-tetrahydropyridine-6-carboxylate.
| Compound Name | ethyl (2S,3S,4R,5S)-3-phenyl-5-propan-2-yl-4-pyrrolidin-1-yl-2-(trifluoromethyl)-2,3,4,5-tetrahydropyridine-6-carboxylate |
|---|---|
| PubChem CID | 11223606 |
| Molecular Formula | C22H29F3N2O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | ethyl (2S,3S,4R,5S)-3-phenyl-5-propan-2-yl-4-pyrrolidin-1-yl-2-(trifluoromethyl)-2,3,4,5-tetrahydropyridine-6-carboxylate |
| SMILES | CCOC(=O)C1=N[C@H](C(F)(F)F)[C@@H](c2ccccc2)[C@@H](N2CCCC2)[C@@H]1C(C)C |
| InChI | InChI=1S/C22H29F3N2O2/c1-4-29-21(28)18-16(14(2)3)19(27-12-8-9-13-27)17(15-10-6-5-7-11-15)20(26-18)22(23,24)25/h5-7,10-11,14,16-17,19-20H,4,8-9,12-13H2,1-3H3/t16-,17+,19+,20+/m1/s1 |
| InChIKey | UNVCDAWDPKFKQZ-UMGGQSCQSA-N |
| XLogP | 4.46 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |