About 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine
9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine (PubChem CID 11223683) has the molecular formula C16H12Cl3N5S
and a molecular weight of 412.73 g/mol. Its IUPAC name is 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine.
Molecular Properties
| Compound Name | 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine |
| PubChem CID | 11223683 |
| Molecular Formula | C16H12Cl3N5S |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine |
| SMILES | C#CCCCn1c(Sc2cc(Cl)c(Cl)cc2Cl)nc2c(N)ncnc21 |
| InChI | InChI=1S/C16H12Cl3N5S/c1-2-3-4-5-24-15-13(14(20)21-8-22-15)23-16(24)25-12-7-10(18)9(17)6-11(12)19/h1,6-8H,3-5H2,(H2,20,21,22) |
| InChIKey | HKCGVSYYAMBCJV-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine?
The IUPAC name of 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine (CID 11223683) is 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine.
What is the SMILES notation for 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine?
The canonical SMILES for 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine is C#CCCCn1c(Sc2cc(Cl)c(Cl)cc2Cl)nc2c(N)ncnc21.
What is the InChIKey of 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine?
The InChIKey is HKCGVSYYAMBCJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Cl3N5S/c1-2-3-4-5-24-15-13(14(20)21-8-22-15)23-16(24)25-12-7-10(18)9(17)6-11(12)19/h1,6-8H,3-5H2,(H2,20,21,22).
What are the key properties of 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine?
9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine has a molecular weight of 412.73 g/mol, XLogP of 4.93, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-pent-4-ynyl-8-(2,4,5-trichlorophenyl)sulfanylpurin-6-amine is sourced from PubChem (CID 11223683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).