C16H8Cl2F6N2 — CID 11223688
2-N,3-N-bis(4-chlorophenyl)-1,1,1,4,4,4-hexafluorobutane-2,3-diimine (PubChem CID 11223688) has the molecular formula C16H8Cl2F6N2 and a molecular weight of 413.15 g/mol. Its IUPAC name is 2-N,3-N-bis(4-chlorophenyl)-1,1,1,4,4,4-hexafluorobutane-2,3-diimine.
| Compound Name | 2-N,3-N-bis(4-chlorophenyl)-1,1,1,4,4,4-hexafluorobutane-2,3-diimine |
|---|---|
| PubChem CID | 11223688 |
| Molecular Formula | C16H8Cl2F6N2 |
| Molecular Weight | 413.15 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | 2-N,3-N-bis(4-chlorophenyl)-1,1,1,4,4,4-hexafluorobutane-2,3-diimine |
| SMILES | FC(F)(F)C(=N\c1ccc(Cl)cc1)/C(=N/c1ccc(Cl)cc1)C(F)(F)F |
| InChI | InChI=1S/C16H8Cl2F6N2/c17-9-1-5-11(6-2-9)25-13(15(19,20)21)14(16(22,23)24)26-12-7-3-10(18)4-8-12/h1-8H/b25-13-,26-14- |
| InChIKey | COQANNBIUXCKTM-WFBNZKAHSA-N |
| XLogP | 6.96 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.15 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|