About 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride
3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride (PubChem CID 11223741) has the molecular formula C17H19ClN2O6S
and a molecular weight of 414.87 g/mol. Its IUPAC name is 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride.
Molecular Properties
| Compound Name | 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride |
| PubChem CID | 11223741 |
| Molecular Formula | C17H19ClN2O6S |
| Molecular Weight | 414.87 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride |
| SMILES | CC(C)N(CCC(=O)Cl)C(=O)c1ccc(S(=O)(=O)N2C(=O)CCC2=O)cc1 |
| InChI | InChI=1S/C17H19ClN2O6S/c1-11(2)19(10-9-14(18)21)17(24)12-3-5-13(6-4-12)27(25,26)20-15(22)7-8-16(20)23/h3-6,11H,7-10H2,1-2H3 |
| InChIKey | JCQIFEPVAFGTAC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 108.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.87 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride?
The IUPAC name of 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride (CID 11223741) is 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride.
What is the SMILES notation for 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride?
The canonical SMILES for 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride is CC(C)N(CCC(=O)Cl)C(=O)c1ccc(S(=O)(=O)N2C(=O)CCC2=O)cc1.
What is the InChIKey of 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride?
The InChIKey is JCQIFEPVAFGTAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN2O6S/c1-11(2)19(10-9-14(18)21)17(24)12-3-5-13(6-4-12)27(25,26)20-15(22)7-8-16(20)23/h3-6,11H,7-10H2,1-2H3.
What are the key properties of 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride?
3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride has a molecular weight of 414.87 g/mol, XLogP of 1.53, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(2,5-dioxopyrrolidin-1-yl)sulfonylbenzoyl]-propan-2-ylamino]propanoyl chloride is sourced from PubChem (CID 11223741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).