C23H28N6O2 — CID 11223897
1-ethyl-3-[2-methoxy-4-[6-[[(1S)-1-pyridin-3-ylbutyl]amino]pyrimidin-4-yl]phenyl]urea (PubChem CID 11223897) has the molecular formula C23H28N6O2 and a molecular weight of 420.52 g/mol. Its IUPAC name is 1-ethyl-3-[2-methoxy-4-[6-[[(1S)-1-pyridin-3-ylbutyl]amino]pyrimidin-4-yl]phenyl]urea.
| Compound Name | 1-ethyl-3-[2-methoxy-4-[6-[[(1S)-1-pyridin-3-ylbutyl]amino]pyrimidin-4-yl]phenyl]urea |
|---|---|
| PubChem CID | 11223897 |
| Molecular Formula | C23H28N6O2 |
| Molecular Weight | 420.52 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1-ethyl-3-[2-methoxy-4-[6-[[(1S)-1-pyridin-3-ylbutyl]amino]pyrimidin-4-yl]phenyl]urea |
| SMILES | CCC[C@H](Nc1cc(-c2ccc(NC(=O)NCC)c(OC)c2)ncn1)c1cccnc1 |
| InChI | InChI=1S/C23H28N6O2/c1-4-7-18(17-8-6-11-24-14-17)28-22-13-20(26-15-27-22)16-9-10-19(21(12-16)31-3)29-23(30)25-5-2/h6,8-15,18H,4-5,7H2,1-3H3,(H2,25,29,30)(H,26,27,28)/t18-/m0/s1 |
| InChIKey | QAOYBJBUNYNPPI-SFHVURJKSA-N |
| XLogP | 4.64 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |