About 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile
4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile (PubChem CID 11223952) has the molecular formula C19H21Cl2N5O2
and a molecular weight of 422.32 g/mol. Its IUPAC name is 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile.
Molecular Properties
| Compound Name | 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile |
| PubChem CID | 11223952 |
| Molecular Formula | C19H21Cl2N5O2 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile |
| SMILES | CCCCN(CC)c1cc(C)nc(Nc2c(Cl)cc(C#N)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H21Cl2N5O2/c1-4-6-7-25(5-2)16-8-12(3)23-19(18(16)26(27)28)24-17-14(20)9-13(11-22)10-15(17)21/h8-10H,4-7H2,1-3H3,(H,23,24) |
| InChIKey | KQZWEWCJBQUUHL-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile?
The IUPAC name of 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile (CID 11223952) is 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile.
What is the SMILES notation for 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile?
The canonical SMILES for 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile is CCCCN(CC)c1cc(C)nc(Nc2c(Cl)cc(C#N)cc2Cl)c1[N+](=O)[O-].
What is the InChIKey of 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile?
The InChIKey is KQZWEWCJBQUUHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21Cl2N5O2/c1-4-6-7-25(5-2)16-8-12(3)23-19(18(16)26(27)28)24-17-14(20)9-13(11-22)10-15(17)21/h8-10H,4-7H2,1-3H3,(H,23,24).
What are the key properties of 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile?
4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile has a molecular weight of 422.32 g/mol, XLogP of 5.85, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[butyl(ethyl)amino]-6-methyl-3-nitro-2-pyridinyl]amino]-3,5-dichlorobenzonitrile is sourced from PubChem (CID 11223952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).