C23H46O3Si2 — CID 11224084
(2S,3R,4E,6E)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dimethylnona-4,6-dienal (PubChem CID 11224084) has the molecular formula C23H46O3Si2 and a molecular weight of 426.79 g/mol. Its IUPAC name is (2S,3R,4E,6E)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dimethylnona-4,6-dienal.
| Compound Name | (2S,3R,4E,6E)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dimethylnona-4,6-dienal |
|---|---|
| PubChem CID | 11224084 |
| Molecular Formula | C23H46O3Si2 |
| Molecular Weight | 426.79 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | (2S,3R,4E,6E)-3,9-bis[[tert-butyl(dimethyl)silyl]oxy]-2,6-dimethylnona-4,6-dienal |
| SMILES | CC(/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=O)=C\CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O3Si2/c1-19(14-13-17-25-27(9,10)22(3,4)5)15-16-21(20(2)18-24)26-28(11,12)23(6,7)8/h14-16,18,20-21H,13,17H2,1-12H3/b16-15+,19-14+/t20-,21-/m1/s1 |
| InChIKey | GIUFZGRFJJSWAC-HKSWRZQQSA-N |
| XLogP | 7.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.79 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|