C25H20FN3O3 — CID 11224139
1-(2-fluorophenyl)-8-(2,3,4-trimethoxyphenyl)imidazo[4,5-c]quinoline (PubChem CID 11224139) has the molecular formula C25H20FN3O3 and a molecular weight of 429.45 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-8-(2,3,4-trimethoxyphenyl)imidazo[4,5-c]quinoline.
| Compound Name | 1-(2-fluorophenyl)-8-(2,3,4-trimethoxyphenyl)imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 11224139 |
| Molecular Formula | C25H20FN3O3 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 1-(2-fluorophenyl)-8-(2,3,4-trimethoxyphenyl)imidazo[4,5-c]quinoline |
| SMILES | COc1ccc(-c2ccc3ncc4ncn(-c5ccccc5F)c4c3c2)c(OC)c1OC |
| InChI | InChI=1S/C25H20FN3O3/c1-30-22-11-9-16(24(31-2)25(22)32-3)15-8-10-19-17(12-15)23-20(13-27-19)28-14-29(23)21-7-5-4-6-18(21)26/h4-14H,1-3H3 |
| InChIKey | OEDLTTXMJKDIMV-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |