C19H29O3PS3 — CID 11224253
(2R,4S)-5-diethoxyphosphoryl-2,6-bis(ethylsulfanyl)-4-phenyl-3,4-dihydro-2H-thiopyran (PubChem CID 11224253) has the molecular formula C19H29O3PS3 and a molecular weight of 432.61 g/mol. Its IUPAC name is (2R,4S)-5-diethoxyphosphoryl-2,6-bis(ethylsulfanyl)-4-phenyl-3,4-dihydro-2H-thiopyran.
| Compound Name | (2R,4S)-5-diethoxyphosphoryl-2,6-bis(ethylsulfanyl)-4-phenyl-3,4-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 11224253 |
| Molecular Formula | C19H29O3PS3 |
| Molecular Weight | 432.61 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | (2R,4S)-5-diethoxyphosphoryl-2,6-bis(ethylsulfanyl)-4-phenyl-3,4-dihydro-2H-thiopyran |
| SMILES | CCOP(=O)(OCC)C1=C(SCC)S[C@@H](SCC)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C19H29O3PS3/c1-5-21-23(20,22-6-2)18-16(15-12-10-9-11-13-15)14-17(24-7-3)26-19(18)25-8-4/h9-13,16-17H,5-8,14H2,1-4H3/t16-,17+/m0/s1 |
| InChIKey | IGIFLVVMWVUAMY-DLBZAZTESA-N |
| XLogP | 7.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.61 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|