C24H48O3Si2 — CID 11224467
(1R,2R,5S)-3-butyl-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1,4-dimethylcyclopent-3-ene-1-carbaldehyde (PubChem CID 11224467) has the molecular formula C24H48O3Si2 and a molecular weight of 440.82 g/mol. Its IUPAC name is (1R,2R,5S)-3-butyl-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1,4-dimethylcyclopent-3-ene-1-carbaldehyde.
| Compound Name | (1R,2R,5S)-3-butyl-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1,4-dimethylcyclopent-3-ene-1-carbaldehyde |
|---|---|
| PubChem CID | 11224467 |
| Molecular Formula | C24H48O3Si2 |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 440.31 |
| IUPAC Name | (1R,2R,5S)-3-butyl-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1,4-dimethylcyclopent-3-ene-1-carbaldehyde |
| SMILES | CCCCC1=C(C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@](C)(C=O)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O3Si2/c1-14-15-16-19-18(2)20(26-28(10,11)22(3,4)5)24(9,17-25)21(19)27-29(12,13)23(6,7)8/h17,20-21H,14-16H2,1-13H3/t20-,21+,24+/m0/s1 |
| InChIKey | OJPWIUZGAXISAI-YZUZCNPQSA-N |
| XLogP | 7.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|