C21H36O10 — CID 11224676
(2R,3S,4S,5R,6S)-2-[[(2R,3S,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(1S)-4-methyl-1-propan-2-ylcyclohex-3-en-1-yl]oxyoxane-3,4,5-triol (PubChem CID 11224676) has the molecular formula C21H36O10 and a molecular weight of 448.51 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-[[(2R,3S,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(1S)-4-methyl-1-propan-2-ylcyclohex-3-en-1-yl]oxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-[[(2R,3S,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(1S)-4-methyl-1-propan-2-ylcyclohex-3-en-1-yl]oxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 11224676 |
| Molecular Formula | C21H36O10 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-[[(2R,3S,4R)-3,4-dihydroxy-4-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(1S)-4-methyl-1-propan-2-ylcyclohex-3-en-1-yl]oxyoxane-3,4,5-triol |
| SMILES | CC1=CC[C@](O[C@@H]2O[C@H](CO[C@@H]3OC[C@](O)(CO)[C@@H]3O)[C@@H](O)[C@H](O)[C@H]2O)(C(C)C)CC1 |
| InChI | InChI=1S/C21H36O10/c1-11(2)21(6-4-12(3)5-7-21)31-18-16(25)15(24)14(23)13(30-18)8-28-19-17(26)20(27,9-22)10-29-19/h4,11,13-19,22-27H,5-10H2,1-3H3/t13-,14-,15+,16-,17-,18+,19-,20-,21-/m1/s1 |
| InChIKey | GYNSVXPOEUJXIG-XZPGJIQJSA-N |
| XLogP | -1.21 |
| TPSA | 158.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|