C29H31F2NO2 — CID 11225047
(1R,5S)-3-[bis(4-fluorophenyl)methoxy]-8-(2-phenylmethoxyethyl)-8-azabicyclo[3.2.1]octane (PubChem CID 11225047) has the molecular formula C29H31F2NO2 and a molecular weight of 463.57 g/mol. Its IUPAC name is (1R,5S)-3-[bis(4-fluorophenyl)methoxy]-8-(2-phenylmethoxyethyl)-8-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-3-[bis(4-fluorophenyl)methoxy]-8-(2-phenylmethoxyethyl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 11225047 |
| Molecular Formula | C29H31F2NO2 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.23 |
| IUPAC Name | (1R,5S)-3-[bis(4-fluorophenyl)methoxy]-8-(2-phenylmethoxyethyl)-8-azabicyclo[3.2.1]octane |
| SMILES | Fc1ccc(C(OC2C[C@H]3CC[C@@H](C2)N3CCOCc2ccccc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C29H31F2NO2/c30-24-10-6-22(7-11-24)29(23-8-12-25(31)13-9-23)34-28-18-26-14-15-27(19-28)32(26)16-17-33-20-21-4-2-1-3-5-21/h1-13,26-29H,14-20H2/t26-,27+,28? |
| InChIKey | PVLOMLBAVRLZPH-FITHBNAOSA-N |
| XLogP | 6.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|