About Unii-0ZN0AQ6sbv
Unii-0ZN0AQ6sbv (PubChem CID 11225102) has the molecular formula C26H38N6O2
and a molecular weight of 466.60 g/mol. Its IUPAC name is N-[(1R,5S)-8-[2-(4-acetylpiperazin-1-yl)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]-1-propan-2-ylindazole-3-carboxamide.
Molecular Properties
| Compound Name | Unii-0ZN0AQ6sbv |
| PubChem CID | 11225102 |
| Molecular Formula | C26H38N6O2 |
| Molecular Weight | 466.60 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | N-[(1R,5S)-8-[2-(4-acetylpiperazin-1-yl)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]-1-propan-2-ylindazole-3-carboxamide |
| SMILES | CC(C)N1C2=CC=CC=C2C(=N1)C(=O)NC3C[C@H]4CC[C@@H](C3)N4CCN5CCN(CC5)C(=O)C |
| InChI | InChI=1S/C26H38N6O2/c1-18(2)32-24-7-5-4-6-23(24)25(28-32)26(34)27-20-16-21-8-9-22(17-20)31(21)15-12-29-10-13-30(14-11-29)19(3)33/h4-7,18,20-22H,8-17H2,1-3H3,(H,27,34)/t20?,21-,22+ |
| InChIKey | ZQMXTDPQEHZTBG-FRIKZZABSA-N |
| XLogP | 2.40 |
| TPSA | 73.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | 725 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 466.60 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Unii-0ZN0AQ6sbv with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Unii-0ZN0AQ6sbv?
The IUPAC name of Unii-0ZN0AQ6sbv (CID 11225102) is N-[(1R,5S)-8-[2-(4-acetylpiperazin-1-yl)ethyl]-8-azabicyclo[3.2.1]octan-3-yl]-1-propan-2-ylindazole-3-carboxamide.
What is the SMILES notation for Unii-0ZN0AQ6sbv?
The canonical SMILES for Unii-0ZN0AQ6sbv is CC(C)N1C2=CC=CC=C2C(=N1)C(=O)NC3C[C@H]4CC[C@@H](C3)N4CCN5CCN(CC5)C(=O)C.
What is the InChIKey of Unii-0ZN0AQ6sbv?
The InChIKey is ZQMXTDPQEHZTBG-FRIKZZABSA-N. The full InChI is InChI=1S/C26H38N6O2/c1-18(2)32-24-7-5-4-6-23(24)25(28-32)26(34)27-20-16-21-8-9-22(17-20)31(21)15-12-29-10-13-30(14-11-29)19(3)33/h4-7,18,20-22H,8-17H2,1-3H3,(H,27,34)/t20?,21-,22+.
What are the key properties of Unii-0ZN0AQ6sbv?
Unii-0ZN0AQ6sbv has a molecular weight of 466.60 g/mol, XLogP of 2.40, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Unii-0ZN0AQ6sbv is sourced from PubChem (CID 11225102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).