C31H46O3 — CID 11225104
methyl (5R,6R,9E,13S)-13-hydroxy-6,10-dimethyl-5-[(E,2R,5S)-5-methylhept-3-en-2-yl]tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene-17-carboxylate (PubChem CID 11225104) has the molecular formula C31H46O3 and a molecular weight of 466.71 g/mol. Its IUPAC name is methyl (5R,6R,9E,13S)-13-hydroxy-6,10-dimethyl-5-[(E,2R,5S)-5-methylhept-3-en-2-yl]tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene-17-carboxylate.
| Compound Name | methyl (5R,6R,9E,13S)-13-hydroxy-6,10-dimethyl-5-[(E,2R,5S)-5-methylhept-3-en-2-yl]tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene-17-carboxylate |
|---|---|
| PubChem CID | 11225104 |
| Molecular Formula | C31H46O3 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.34 |
| IUPAC Name | methyl (5R,6R,9E,13S)-13-hydroxy-6,10-dimethyl-5-[(E,2R,5S)-5-methylhept-3-en-2-yl]tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraene-17-carboxylate |
| SMILES | CC[C@H](C)/C=C/[C@@H](C)[C@H]1CCC2c3ccc(cc3C(=O)OC)C[C@@H](O)CC/C(C)=C/CC[C@@]21C |
| InChI | InChI=1S/C31H46O3/c1-7-21(2)10-12-23(4)28-16-17-29-26-15-13-24(20-27(26)30(33)34-6)19-25(32)14-11-22(3)9-8-18-31(28,29)5/h9-10,12-13,15,20-21,23,25,28-29,32H,7-8,11,14,16-19H2,1-6H3/b12-10+,22-9+/t21-,23+,25-,28+,29?,31+/m0/s1 |
| InChIKey | BCZHPGRUNTYBSL-PNWFAAKISA-N |
| XLogP | 7.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|