C27H46N2O5 — CID 11225357
tert-butyl (2R,4R,5S)-5-acetamido-4-acetyloxy-2-[(6E,8E)-trideca-6,8-dienyl]piperidine-1-carboxylate (PubChem CID 11225357) has the molecular formula C27H46N2O5 and a molecular weight of 478.67 g/mol. Its IUPAC name is tert-butyl (2R,4R,5S)-5-acetamido-4-acetyloxy-2-[(6E,8E)-trideca-6,8-dienyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (2R,4R,5S)-5-acetamido-4-acetyloxy-2-[(6E,8E)-trideca-6,8-dienyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11225357 |
| Molecular Formula | C27H46N2O5 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | tert-butyl (2R,4R,5S)-5-acetamido-4-acetyloxy-2-[(6E,8E)-trideca-6,8-dienyl]piperidine-1-carboxylate |
| SMILES | CCCC/C=C/C=C/CCCCC[C@@H]1C[C@@H](OC(C)=O)[C@@H](NC(C)=O)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H46N2O5/c1-7-8-9-10-11-12-13-14-15-16-17-18-23-19-25(33-22(3)31)24(28-21(2)30)20-29(23)26(32)34-27(4,5)6/h10-13,23-25H,7-9,14-20H2,1-6H3,(H,28,30)/b11-10+,13-12+/t23-,24+,25-/m1/s1 |
| InChIKey | FJRYEOIJUITMIU-VYHUIDMOSA-N |
| XLogP | 5.69 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|