C28H33N5O3 — CID 11225534
1-[(2R)-1-hydroxy-4-[6-(6-phenylhexanoylamino)indol-1-yl]butan-2-yl]imidazole-4-carboxamide (PubChem CID 11225534) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 1-[(2R)-1-hydroxy-4-[6-(6-phenylhexanoylamino)indol-1-yl]butan-2-yl]imidazole-4-carboxamide.
| Compound Name | 1-[(2R)-1-hydroxy-4-[6-(6-phenylhexanoylamino)indol-1-yl]butan-2-yl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 11225534 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 1-[(2R)-1-hydroxy-4-[6-(6-phenylhexanoylamino)indol-1-yl]butan-2-yl]imidazole-4-carboxamide |
| SMILES | NC(=O)c1cn([C@@H](CO)CCn2ccc3ccc(NC(=O)CCCCCc4ccccc4)cc32)cn1 |
| InChI | InChI=1S/C28H33N5O3/c29-28(36)25-18-33(20-30-25)24(19-34)14-16-32-15-13-22-11-12-23(17-26(22)32)31-27(35)10-6-2-5-9-21-7-3-1-4-8-21/h1,3-4,7-8,11-13,15,17-18,20,24,34H,2,5-6,9-10,14,16,19H2,(H2,29,36)(H,31,35)/t24-/m1/s1 |
| InChIKey | IVAFIEQIVZYOAV-XMMPIXPASA-N |
| XLogP | 4.30 |
| TPSA | 115.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|