C21H24Cl2N6O4 — CID 11225680
N-[2,2-dichloro-1-[(Z)-[(cyanoamino)-[(2-methoxy-3-pyridinyl)amino]methylidene]amino]propyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 11225680) has the molecular formula C21H24Cl2N6O4 and a molecular weight of 495.37 g/mol. Its IUPAC name is N-[2,2-dichloro-1-[(Z)-[(cyanoamino)-[(2-methoxy-3-pyridinyl)amino]methylidene]amino]propyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[2,2-dichloro-1-[(Z)-[(cyanoamino)-[(2-methoxy-3-pyridinyl)amino]methylidene]amino]propyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 11225680 |
| Molecular Formula | C21H24Cl2N6O4 |
| Molecular Weight | 495.37 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-[2,2-dichloro-1-[(Z)-[(cyanoamino)-[(2-methoxy-3-pyridinyl)amino]methylidene]amino]propyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NC(/N=C(\NC#N)Nc2cccnc2OC)C(C)(Cl)Cl)cc1OC |
| InChI | InChI=1S/C21H24Cl2N6O4/c1-21(22,23)19(28-17(30)11-13-7-8-15(31-2)16(10-13)32-3)29-20(26-12-24)27-14-6-5-9-25-18(14)33-4/h5-10,19H,11H2,1-4H3,(H,28,30)(H2,26,27,29) |
| InChIKey | ORBQRCOUYGUISE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 129.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|