C26H33F3O6 — CID 11225753
[(1S,2S,2'R,3aS,5R,7S,7aR)-1-hydroxy-2'-methoxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-5-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 11225753) has the molecular formula C26H33F3O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is [(1S,2S,2'R,3aS,5R,7S,7aR)-1-hydroxy-2'-methoxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-5-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S,2S,2'R,3aS,5R,7S,7aR)-1-hydroxy-2'-methoxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-5-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 11225753 |
| Molecular Formula | C26H33F3O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | [(1S,2S,2'R,3aS,5R,7S,7aR)-1-hydroxy-2'-methoxy-7,7a-dimethyl-4'-methylidenespiro[3,3a,4,5,6,7-hexahydro-1H-indene-2,3'-oxolane]-5-yl] (2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C1CO[C@@H](OC)[C@@]12C[C@H]1C[C@H](OC(=O)[C@](OC)(c3ccccc3)C(F)(F)F)C[C@H](C)[C@@]1(C)[C@@H]2O |
| InChI | InChI=1S/C26H33F3O6/c1-15-11-19(35-21(31)25(33-5,26(27,28)29)17-9-7-6-8-10-17)12-18-13-24(20(30)23(15,18)3)16(2)14-34-22(24)32-4/h6-10,15,18-20,22,30H,2,11-14H2,1,3-5H3/t15-,18+,19+,20-,22+,23+,24-,25+/m0/s1 |
| InChIKey | SOKDNFPPEPNVJW-RBRPIHROSA-N |
| XLogP | 4.36 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|