C28H33ClO4S — CID 11225814
S-(4-chlorophenyl) (1S,2S,4aS,4bS,10aR)-4b,8,8,10a-tetramethyl-2',5-dioxospiro[3,4,4a,8a,9,10-hexahydro-2H-phenanthrene-1,4'-oxolane]-2-carbothioate (PubChem CID 11225814) has the molecular formula C28H33ClO4S and a molecular weight of 501.09 g/mol. Its IUPAC name is S-(4-chlorophenyl) (1S,2S,4aS,4bS,10aR)-4b,8,8,10a-tetramethyl-2',5-dioxospiro[3,4,4a,8a,9,10-hexahydro-2H-phenanthrene-1,4'-oxolane]-2-carbothioate.
| Compound Name | S-(4-chlorophenyl) (1S,2S,4aS,4bS,10aR)-4b,8,8,10a-tetramethyl-2',5-dioxospiro[3,4,4a,8a,9,10-hexahydro-2H-phenanthrene-1,4'-oxolane]-2-carbothioate |
|---|---|
| PubChem CID | 11225814 |
| Molecular Formula | C28H33ClO4S |
| Molecular Weight | 501.09 g/mol |
| Exact Mass | 500.18 |
| IUPAC Name | S-(4-chlorophenyl) (1S,2S,4aS,4bS,10aR)-4b,8,8,10a-tetramethyl-2',5-dioxospiro[3,4,4a,8a,9,10-hexahydro-2H-phenanthrene-1,4'-oxolane]-2-carbothioate |
| SMILES | CC1(C)C=CC(=O)[C@@]2(C)C1CC[C@]1(C)[C@@H]2CC[C@H](C(=O)Sc2ccc(Cl)cc2)[C@]12COC(=O)C2 |
| InChI | InChI=1S/C28H33ClO4S/c1-25(2)13-12-22(30)27(4)20(25)11-14-26(3)21(27)10-9-19(28(26)15-23(31)33-16-28)24(32)34-18-7-5-17(29)6-8-18/h5-8,12-13,19-21H,9-11,14-16H2,1-4H3/t19-,20?,21+,26-,27+,28+/m1/s1 |
| InChIKey | UUJJPWOHSWCAKY-ILLKDXPSSA-N |
| XLogP | 6.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.09 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|