C31H34O8 — CID 11226405
2-[(2R,3R,4R,5R,6R)-4-acetyloxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetic acid (PubChem CID 11226405) has the molecular formula C31H34O8 and a molecular weight of 534.61 g/mol. Its IUPAC name is 2-[(2R,3R,4R,5R,6R)-4-acetyloxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4R,5R,6R)-4-acetyloxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 11226405 |
| Molecular Formula | C31H34O8 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | 2-[(2R,3R,4R,5R,6R)-4-acetyloxy-3,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]acetic acid |
| SMILES | CC(=O)O[C@H]1[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@H](CC(=O)O)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C31H34O8/c1-22(32)38-31-29(36-19-24-13-7-3-8-14-24)26(17-28(33)34)39-27(21-35-18-23-11-5-2-6-12-23)30(31)37-20-25-15-9-4-10-16-25/h2-16,26-27,29-31H,17-21H2,1H3,(H,33,34)/t26-,27-,29-,30-,31-/m1/s1 |
| InChIKey | LJSRSZBMGGDARF-JIFLTSPRSA-N |
| XLogP | 4.55 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |