C26H26ClFN6O3S — CID 11226714
N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-[2-(dimethylamino)-2-oxoethyl]sulfanylphenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide (PubChem CID 11226714) has the molecular formula C26H26ClFN6O3S and a molecular weight of 557.05 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-[2-(dimethylamino)-2-oxoethyl]sulfanylphenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-[2-(dimethylamino)-2-oxoethyl]sulfanylphenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide |
|---|---|
| PubChem CID | 11226714 |
| Molecular Formula | C26H26ClFN6O3S |
| Molecular Weight | 557.05 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)carbamoyl]-4-[2-(dimethylamino)-2-oxoethyl]sulfanylphenyl]-4-(N,N-dimethylcarbamimidoyl)-2-fluorobenzamide |
| SMILES | [H]/N=C(/c1ccc(C(=O)Nc2ccc(SCC(=O)N(C)C)cc2C(=O)Nc2ccc(Cl)cn2)c(F)c1)N(C)C |
| InChI | InChI=1S/C26H26ClFN6O3S/c1-33(2)23(35)14-38-17-7-9-21(19(12-17)26(37)32-22-10-6-16(27)13-30-22)31-25(36)18-8-5-15(11-20(18)28)24(29)34(3)4/h5-13,29H,14H2,1-4H3,(H,31,36)(H,30,32,37)/b29-24- |
| InChIKey | BQERBZSULJGCSN-OLFWJLLRSA-N |
| XLogP | 4.45 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.05 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|