C23H23F5O11S — CID 11227220
(2,3,4,5,6-pentafluorophenyl) 3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylpropanoate (PubChem CID 11227220) has the molecular formula C23H23F5O11S and a molecular weight of 602.48 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylpropanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 11227220 |
| Molecular Formula | C23H23F5O11S |
| Molecular Weight | 602.48 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 3-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanylpropanoate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SCCC(=O)Oc2c(F)c(F)c(F)c(F)c2F)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C23H23F5O11S/c1-8(29)34-7-12-19(35-9(2)30)21(36-10(3)31)22(37-11(4)32)23(38-12)40-6-5-13(33)39-20-17(27)15(25)14(24)16(26)18(20)28/h12,19,21-23H,5-7H2,1-4H3/t12-,19-,21+,22-,23+/m1/s1 |
| InChIKey | IAWGPGFJUAHBHX-XXXBMZKQSA-N |
| XLogP | 2.49 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|