C31H35N3O8S — CID 11227280
4-[2-(methylsulfonylcarbamoyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid (PubChem CID 11227280) has the molecular formula C31H35N3O8S and a molecular weight of 609.70 g/mol. Its IUPAC name is 4-[2-(methylsulfonylcarbamoyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid.
| Compound Name | 4-[2-(methylsulfonylcarbamoyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid |
|---|---|
| PubChem CID | 11227280 |
| Molecular Formula | C31H35N3O8S |
| Molecular Weight | 609.70 g/mol |
| Exact Mass | 609.21 |
| IUPAC Name | 4-[2-(methylsulfonylcarbamoyl)-8-[[4-(4-phenylbutoxy)benzoyl]amino]-2,3-dihydro-1,4-benzoxazin-4-yl]butanoic acid |
| SMILES | CS(=O)(=O)NC(=O)C1CN(CCCC(=O)O)c2cccc(NC(=O)c3ccc(OCCCCc4ccccc4)cc3)c2O1 |
| InChI | InChI=1S/C31H35N3O8S/c1-43(39,40)33-31(38)27-21-34(19-8-14-28(35)36)26-13-7-12-25(29(26)42-27)32-30(37)23-15-17-24(18-16-23)41-20-6-5-11-22-9-3-2-4-10-22/h2-4,7,9-10,12-13,15-18,27H,5-6,8,11,14,19-21H2,1H3,(H,32,37)(H,33,38)(H,35,36) |
| InChIKey | XFDWMOIFWMJDPH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.70 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|