About 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole
4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole (PubChem CID 11227677) has the molecular formula C18H12Br4N2O2S2
and a molecular weight of 672.06 g/mol. Its IUPAC name is 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole.
Molecular Properties
| Compound Name | 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole |
| PubChem CID | 11227677 |
| Molecular Formula | C18H12Br4N2O2S2 |
| Molecular Weight | 672.06 g/mol |
| Exact Mass | 667.71 |
| IUPAC Name | 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole |
| SMILES | CS(=O)c1[nH]c2cc(Br)cc(Br)c2c1-c1c(S(C)=O)[nH]c2cc(Br)cc(Br)c12 |
| InChI | InChI=1S/C18H12Br4N2O2S2/c1-27(25)17-15(13-9(21)3-7(19)5-11(13)23-17)16-14-10(22)4-8(20)6-12(14)24-18(16)28(2)26/h3-6,23-24H,1-2H3 |
| InChIKey | XBHNQXJFFIJLEG-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 672.06 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole?
The IUPAC name of 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole (CID 11227677) is 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole.
What is the SMILES notation for 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole?
The canonical SMILES for 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole is CS(=O)c1[nH]c2cc(Br)cc(Br)c2c1-c1c(S(C)=O)[nH]c2cc(Br)cc(Br)c12.
What is the InChIKey of 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole?
The InChIKey is XBHNQXJFFIJLEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12Br4N2O2S2/c1-27(25)17-15(13-9(21)3-7(19)5-11(13)23-17)16-14-10(22)4-8(20)6-12(14)24-18(16)28(2)26/h3-6,23-24H,1-2H3.
What are the key properties of 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole?
4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole has a molecular weight of 672.06 g/mol, XLogP of 6.84, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dibromo-3-(4,6-dibromo-2-methylsulfinyl-1H-indol-3-yl)-2-methylsulfinyl-1H-indole is sourced from PubChem (CID 11227677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).