C31H53BrO9Si — CID 11227706
methyl (4E,7S,8R,9Z,11E,13E)-10-bromo-8-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxypentadeca-4,9,11,13-tetraenoate (PubChem CID 11227706) has the molecular formula C31H53BrO9Si and a molecular weight of 677.75 g/mol. Its IUPAC name is methyl (4E,7S,8R,9Z,11E,13E)-10-bromo-8-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxypentadeca-4,9,11,13-tetraenoate.
| Compound Name | methyl (4E,7S,8R,9Z,11E,13E)-10-bromo-8-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxypentadeca-4,9,11,13-tetraenoate |
|---|---|
| PubChem CID | 11227706 |
| Molecular Formula | C31H53BrO9Si |
| Molecular Weight | 677.75 g/mol |
| Exact Mass | 676.26 |
| IUPAC Name | methyl (4E,7S,8R,9Z,11E,13E)-10-bromo-8-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-7-[(2S,3R,4R,5S,6S)-3,4,5-trimethoxy-6-methyloxan-2-yl]oxypentadeca-4,9,11,13-tetraenoate |
| SMILES | COC(=O)CC/C=C/C[C@H](O[C@@H]1O[C@@H](C)[C@H](OC)[C@@H](OC)[C@H]1OC)[C@@H](/C=C(Br)/C=C/C=C/CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H53BrO9Si/c1-22-27(36-6)28(37-7)29(38-8)30(39-22)40-24(18-14-11-15-19-26(34)35-5)25(41-42(9,10)31(2,3)4)21-23(32)17-13-12-16-20-33/h11-14,16-17,21-22,24-25,27-30,33H,15,18-20H2,1-10H3/b14-11+,16-12+,17-13+,23-21-/t22-,24-,25+,27-,28+,29+,30-/m0/s1 |
| InChIKey | RAYKRCLCYFMLCV-UOMIGVNESA-N |
| XLogP | 5.83 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.75 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|