About CID 11228015
CID 11228015 (PubChem CID 11228015) has the molecular formula C12H19O
and a molecular weight of 179.28 g/mol.
Molecular Properties
| Compound Name | CID 11228015 |
| PubChem CID | 11228015 |
| Molecular Formula | C12H19O |
| Molecular Weight | 179.28 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | — |
| SMILES | CCOC[C]1[C](C)[C](C)[C](C)[C]1C |
| InChI | InChI=1S/C12H19O/c1-6-13-7-12-10(4)8(2)9(3)11(12)5/h6-7H2,1-5H3 |
| InChIKey | RHUDBMYXXDPGMM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 11228015 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11228015?
The IUPAC name of CID 11228015 (CID 11228015) is not available.
What is the SMILES notation for CID 11228015?
The canonical SMILES for CID 11228015 is CCOC[C]1[C](C)[C](C)[C](C)[C]1C.
What is the InChIKey of CID 11228015?
The InChIKey is RHUDBMYXXDPGMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19O/c1-6-13-7-12-10(4)8(2)9(3)11(12)5/h6-7H2,1-5H3.
What are the key properties of CID 11228015?
CID 11228015 has a molecular weight of 179.28 g/mol, XLogP of 2.99, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11228015 is sourced from PubChem (CID 11228015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).