C41H84O3Si2Sn — CID 11228144
3-[(1S,2R,4aR,8aR)-1,4a-dimethyl-6-(tributylstannylmethoxymethyl)-2-triethylsilyloxy-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]propoxy-tert-butyl-dimethylsilane (PubChem CID 11228144) has the molecular formula C41H84O3Si2Sn and a molecular weight of 800.00 g/mol. Its IUPAC name is 3-[(1S,2R,4aR,8aR)-1,4a-dimethyl-6-(tributylstannylmethoxymethyl)-2-triethylsilyloxy-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]propoxy-tert-butyl-dimethylsilane.
| Compound Name | 3-[(1S,2R,4aR,8aR)-1,4a-dimethyl-6-(tributylstannylmethoxymethyl)-2-triethylsilyloxy-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]propoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11228144 |
| Molecular Formula | C41H84O3Si2Sn |
| Molecular Weight | 800.00 g/mol |
| Exact Mass | 800.50 |
| IUPAC Name | 3-[(1S,2R,4aR,8aR)-1,4a-dimethyl-6-(tributylstannylmethoxymethyl)-2-triethylsilyloxy-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]propoxy-tert-butyl-dimethylsilane |
| SMILES | CCCC[Sn](CCCC)(CCCC)COCC1=C[C@@]2(C)CC[C@@H](O[Si](CC)(CC)CC)[C@@](C)(CCCO[Si](C)(C)C(C)(C)C)[C@@H]2CC1 |
| InChI | InChI=1S/C29H57O3Si2.3C4H9.Sn/c1-12-34(13-2,14-3)32-26-18-20-28(7)22-24(23-30-9)16-17-25(28)29(26,8)19-15-21-31-33(10,11)27(4,5)6;3*1-3-4-2;/h22,25-26H,9,12-21,23H2,1-8,10-11H3;3*1,3-4H2,2H3;/t25-,26-,28-,29+;;;;/m1..../s1 |
| InChIKey | KUILQHSBVCWSDW-FMPWINPWSA-N |
| XLogP | 13.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.00 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|