About CID 11228256
CID 11228256 (PubChem CID 11228256) has the molecular formula C46H65Cl2N2PRu
and a molecular weight of 848.99 g/mol.
Molecular Properties
| Compound Name | CID 11228256 |
| PubChem CID | 11228256 |
| Molecular Formula | C46H65Cl2N2PRu |
| Molecular Weight | 848.99 g/mol |
| Exact Mass | 848.33 |
| IUPAC Name | — |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.Cc1cc(C)c(N2[C]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.Cl[Ru](Cl)=Cc1ccccc1 |
| InChI | InChI=1S/C21H26N2.C18H33P.C7H6.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;;;/h9-12H,7-8H2,1-6H3;16-18H,1-15H2;1-6H;2*1H;/q;;;;;+2/p-2 |
| InChIKey | FCDPQMAOJARMTG-UHFFFAOYSA-L |
| XLogP | 14.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 848.99 |
| LogP ≤ 5 | 14.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 11228256 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11228256?
The IUPAC name of CID 11228256 (CID 11228256) is not available.
What is the SMILES notation for CID 11228256?
The canonical SMILES for CID 11228256 is C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.Cc1cc(C)c(N2[C]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.Cl[Ru](Cl)=Cc1ccccc1.
What is the InChIKey of CID 11228256?
The InChIKey is FCDPQMAOJARMTG-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H26N2.C18H33P.C7H6.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-7-5-3-2-4-6-7;;;/h9-12H,7-8H2,1-6H3;16-18H,1-15H2;1-6H;2*1H;/q;;;;;+2/p-2.
What are the key properties of CID 11228256?
CID 11228256 has a molecular weight of 848.99 g/mol, XLogP of 14.09, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11228256 is sourced from PubChem (CID 11228256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).