C42H38N4O4+2 — CID 11228494
4,15,28,39-tetraoxa-18,42-diaza-1,25-diazonianonacyclo[40.6.1.118,25.05,14.07,12.019,24.029,38.031,36.043,48]pentaconta-1(49),5,7,9,11,13,19,21,23,25(50),29,31,33,35,37,43,45,47-octadecaene (PubChem CID 11228494) has the molecular formula C42H38N4O4+2 and a molecular weight of 662.79 g/mol. Its IUPAC name is 4,15,28,39-tetraoxa-18,42-diaza-1,25-diazonianonacyclo[40.6.1.118,25.05,14.07,12.019,24.029,38.031,36.043,48]pentaconta-1(49),5,7,9,11,13,19,21,23,25(50),29,31,33,35,37,43,45,47-octadecaene.
| Compound Name | 4,15,28,39-tetraoxa-18,42-diaza-1,25-diazonianonacyclo[40.6.1.118,25.05,14.07,12.019,24.029,38.031,36.043,48]pentaconta-1(49),5,7,9,11,13,19,21,23,25(50),29,31,33,35,37,43,45,47-octadecaene |
|---|---|
| PubChem CID | 11228494 |
| Molecular Formula | C42H38N4O4+2 |
| Molecular Weight | 662.79 g/mol |
| Exact Mass | 662.29 |
| IUPAC Name | 4,15,28,39-tetraoxa-18,42-diaza-1,25-diazonianonacyclo[40.6.1.118,25.05,14.07,12.019,24.029,38.031,36.043,48]pentaconta-1(49),5,7,9,11,13,19,21,23,25(50),29,31,33,35,37,43,45,47-octadecaene |
| SMILES | c1ccc2cc3c(cc2c1)OCCn1c[n+](c2ccccc21)CCOc1cc2ccccc2cc1OCCn1c[n+](c2ccccc21)CCO3 |
| InChI | InChI=1S/C42H38N4O4/c1-2-10-32-26-40-39(25-31(32)9-1)47-21-17-43-29-45(36-14-6-5-13-35(36)43)19-23-49-41-27-33-11-3-4-12-34(33)28-42(41)50-24-20-46-30-44(18-22-48-40)37-15-7-8-16-38(37)46/h1-16,25-30H,17-24H2/q+2 |
| InChIKey | ZQJAQKWYAQNOAN-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 54.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.79 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|