About 4-methoxy-N,N-dimethylbutanamide
4-methoxy-N,N-dimethylbutanamide (PubChem CID 11228870) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 4-methoxy-N,N-dimethylbutanamide |
| PubChem CID | 11228870 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 4-methoxy-N,N-dimethylbutanamide |
| SMILES | COCCCC(=O)N(C)C |
| InChI | InChI=1S/C7H15NO2/c1-8(2)7(9)5-4-6-10-3/h4-6H2,1-3H3 |
| InChIKey | KHSFOXWYBQGJMD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N,N-dimethylbutanamide?
The IUPAC name of 4-methoxy-N,N-dimethylbutanamide (CID 11228870) is 4-methoxy-N,N-dimethylbutanamide.
What is the SMILES notation for 4-methoxy-N,N-dimethylbutanamide?
The canonical SMILES for 4-methoxy-N,N-dimethylbutanamide is COCCCC(=O)N(C)C.
What is the InChIKey of 4-methoxy-N,N-dimethylbutanamide?
The InChIKey is KHSFOXWYBQGJMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-8(2)7(9)5-4-6-10-3/h4-6H2,1-3H3.
What are the key properties of 4-methoxy-N,N-dimethylbutanamide?
4-methoxy-N,N-dimethylbutanamide has a molecular weight of 145.20 g/mol, XLogP of 0.50, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N,N-dimethylbutanamide is sourced from PubChem (CID 11228870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).