About 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide
3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide (PubChem CID 11228995) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide |
| PubChem CID | 11228995 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide |
| SMILES | NC(=O)c1nn2c(c1N)CCC2 |
| InChI | InChI=1S/C7H10N4O/c8-5-4-2-1-3-11(4)10-6(5)7(9)12/h1-3,8H2,(H2,9,12) |
| InChIKey | UFMLLYLQFULXCH-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide?
The IUPAC name of 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide (CID 11228995) is 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide.
What is the SMILES notation for 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide?
The canonical SMILES for 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide is NC(=O)c1nn2c(c1N)CCC2.
What is the InChIKey of 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide?
The InChIKey is UFMLLYLQFULXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c8-5-4-2-1-3-11(4)10-6(5)7(9)12/h1-3,8H2,(H2,9,12).
What are the key properties of 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide?
3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide has a molecular weight of 166.18 g/mol, XLogP of -0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5,6-dihydro-4H-pyrrolo[1,2-b]pyrazole-2-carboxamide is sourced from PubChem (CID 11228995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).