C10H18O2 — CID 11229042
(2E,6R)-3,7-dimethylocta-2,7-diene-1,6-diol (PubChem CID 11229042) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (2E,6R)-3,7-dimethylocta-2,7-diene-1,6-diol.
| Compound Name | (2E,6R)-3,7-dimethylocta-2,7-diene-1,6-diol |
|---|---|
| PubChem CID | 11229042 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (2E,6R)-3,7-dimethylocta-2,7-diene-1,6-diol |
| SMILES | C=C(C)[C@H](O)CC/C(C)=C/CO |
| InChI | InChI=1S/C10H18O2/c1-8(2)10(12)5-4-9(3)6-7-11/h6,10-12H,1,4-5,7H2,2-3H3/b9-6+/t10-/m1/s1 |
| InChIKey | FRUCUVNBDSNCEC-OLKPEBQYSA-N |
| XLogP | 1.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|