About 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid
3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid (PubChem CID 11229076) has the molecular formula C8H14O4
and a molecular weight of 174.20 g/mol. Its IUPAC name is 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid.
Molecular Properties
| Compound Name | 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid |
| PubChem CID | 11229076 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid |
| SMILES | CC1(C)OC[C@@H](CCC(=O)O)O1 |
| InChI | InChI=1S/C8H14O4/c1-8(2)11-5-6(12-8)3-4-7(9)10/h6H,3-5H2,1-2H3,(H,9,10)/t6-/m1/s1 |
| InChIKey | VOIMKESBBFHOSH-ZCFIWIBFSA-N |
| XLogP | 1.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid?
The IUPAC name of 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid (CID 11229076) is 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid.
What is the SMILES notation for 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid?
The canonical SMILES for 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid is CC1(C)OC[C@@H](CCC(=O)O)O1.
What is the InChIKey of 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid?
The InChIKey is VOIMKESBBFHOSH-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H14O4/c1-8(2)11-5-6(12-8)3-4-7(9)10/h6H,3-5H2,1-2H3,(H,9,10)/t6-/m1/s1.
What are the key properties of 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid?
3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid has a molecular weight of 174.20 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]propanoic acid is sourced from PubChem (CID 11229076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).