About tetramethylazanium;trifluoromethanethiolate
tetramethylazanium;trifluoromethanethiolate (PubChem CID 11229088) has the molecular formula C5H12F3NS
and a molecular weight of 175.22 g/mol. Its IUPAC name is tetramethylazanium;trifluoromethanethiolate.
Molecular Properties
| Compound Name | tetramethylazanium;trifluoromethanethiolate |
| PubChem CID | 11229088 |
| Molecular Formula | C5H12F3NS |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | tetramethylazanium;trifluoromethanethiolate |
| SMILES | C[N+](C)(C)C.FC(F)(F)[S-] |
| InChI | InChI=1S/C4H12N.CHF3S/c1-5(2,3)4;2-1(3,4)5/h1-4H3;5H/q+1;/p-1 |
| InChIKey | LTONLRVDOIFITJ-UHFFFAOYSA-M |
| XLogP | 1.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze tetramethylazanium;trifluoromethanethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetramethylazanium;trifluoromethanethiolate?
The IUPAC name of tetramethylazanium;trifluoromethanethiolate (CID 11229088) is tetramethylazanium;trifluoromethanethiolate.
What is the SMILES notation for tetramethylazanium;trifluoromethanethiolate?
The canonical SMILES for tetramethylazanium;trifluoromethanethiolate is C[N+](C)(C)C.FC(F)(F)[S-].
What is the InChIKey of tetramethylazanium;trifluoromethanethiolate?
The InChIKey is LTONLRVDOIFITJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H12N.CHF3S/c1-5(2,3)4;2-1(3,4)5/h1-4H3;5H/q+1;/p-1.
What are the key properties of tetramethylazanium;trifluoromethanethiolate?
tetramethylazanium;trifluoromethanethiolate has a molecular weight of 175.22 g/mol, XLogP of 1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tetramethylazanium;trifluoromethanethiolate is sourced from PubChem (CID 11229088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).