About 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene
1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene (PubChem CID 11229119) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene.
Molecular Properties
| Compound Name | 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene |
| PubChem CID | 11229119 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene |
| SMILES | C=C/C=C(/OCC)C1=CCCCC1 |
| InChI | InChI=1S/C12H18O/c1-3-8-12(13-4-2)11-9-6-5-7-10-11/h3,8-9H,1,4-7,10H2,2H3/b12-8+ |
| InChIKey | ZNBVDZBZDAASTR-XYOKQWHBSA-N |
| XLogP | 3.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene?
The IUPAC name of 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene (CID 11229119) is 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene.
What is the SMILES notation for 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene?
The canonical SMILES for 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene is C=C/C=C(/OCC)C1=CCCCC1.
What is the InChIKey of 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene?
The InChIKey is ZNBVDZBZDAASTR-XYOKQWHBSA-N. The full InChI is InChI=1S/C12H18O/c1-3-8-12(13-4-2)11-9-6-5-7-10-11/h3,8-9H,1,4-7,10H2,2H3/b12-8+.
What are the key properties of 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene?
1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene has a molecular weight of 178.27 g/mol, XLogP of 3.59, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1E)-1-ethoxybuta-1,3-dienyl]cyclohexene is sourced from PubChem (CID 11229119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).