About 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde
6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde (PubChem CID 11229132) has the molecular formula C10H9FO2
and a molecular weight of 180.18 g/mol. Its IUPAC name is 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde.
Molecular Properties
| Compound Name | 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde |
| PubChem CID | 11229132 |
| Molecular Formula | C10H9FO2 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde |
| SMILES | O=Cc1cc(F)cc2c1OCCC2 |
| InChI | InChI=1S/C10H9FO2/c11-9-4-7-2-1-3-13-10(7)8(5-9)6-12/h4-6H,1-3H2 |
| InChIKey | RSVLOWLCSDVHKN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde?
The IUPAC name of 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde (CID 11229132) is 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde.
What is the SMILES notation for 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde?
The canonical SMILES for 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde is O=Cc1cc(F)cc2c1OCCC2.
What is the InChIKey of 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde?
The InChIKey is RSVLOWLCSDVHKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO2/c11-9-4-7-2-1-3-13-10(7)8(5-9)6-12/h4-6H,1-3H2.
What are the key properties of 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde?
6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde has a molecular weight of 180.18 g/mol, XLogP of 1.96, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-3,4-dihydro-2H-chromene-8-carbaldehyde is sourced from PubChem (CID 11229132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).