C10H18O3 — CID 11229214
(1S,2S,3R)-2-methyl-5-propan-2-ylcyclohex-4-ene-1,2,3-triol (PubChem CID 11229214) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (1S,2S,3R)-2-methyl-5-propan-2-ylcyclohex-4-ene-1,2,3-triol.
| Compound Name | (1S,2S,3R)-2-methyl-5-propan-2-ylcyclohex-4-ene-1,2,3-triol |
|---|---|
| PubChem CID | 11229214 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (1S,2S,3R)-2-methyl-5-propan-2-ylcyclohex-4-ene-1,2,3-triol |
| SMILES | CC(C)C1=C[C@@H](O)[C@@](C)(O)[C@@H](O)C1 |
| InChI | InChI=1S/C10H18O3/c1-6(2)7-4-8(11)10(3,13)9(12)5-7/h4,6,8-9,11-13H,5H2,1-3H3/t8-,9+,10-/m1/s1 |
| InChIKey | RMGKQNBOGFMCHX-KXUCPTDWSA-N |
| XLogP | 0.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|